CAS 61735-56-6 appears in our catalog under these names: 5-Iodonaphthalen-1-ol, 95%, 5-Iodonaphthalen-1-ol, 95-<97%, 5-Iodonaphthalen-1-ol, ≥97-<99%, 5-Iodonaphthalen-1-ol, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 1g, 250mg, 2,5g, 5g, 10g, 25g, 50g.
5-iodonaphthalen-1-ol (CAS 61735-56-6) is a chemical compound with the molecular formula C10H7IO and a molecular weight of 270.07 g/mol. IUPAC name: 5-iodonaphthalen-1-ol. InChIKey: YLGOKRRRCVJVLM-UHFFFAOYSA-N.
| Molecular formula | C10H7IO |
|---|---|
| Molecular weight | 270.07 g/mol |
| IUPAC name | 5-iodonaphthalen-1-ol |
| InChIKey | YLGOKRRRCVJVLM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2I)C(=C1)O |
Computed by PubChem (NCBI)