CAS 113890-38-3 appears in our catalog under these names: Brivudine Impurity 19, Brivudine Impurity 28, 2-Deoxy-b-L-erythro-pentofuranose. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 25mg, 50mg, 100mg, 250mg.
(2S,4R,5S)-5-(hydroxymethyl)oxolane-2,4-diol (CAS 113890-38-3) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (2S,4R,5S)-5-(hydroxymethyl)oxolane-2,4-diol. InChIKey: PDWIQYODPROSQH-WISUUJSJSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (2S,4R,5S)-5-(hydroxymethyl)oxolane-2,4-diol |
| InChIKey | PDWIQYODPROSQH-WISUUJSJSA-N |
| SMILES | C1[C@H]([C@@H](O[C@@H]1O)CO)O |
Computed by PubChem (NCBI)