CAS 1139-52-2 appears in our catalog under these names: 4-Bromo-2,6-di-tert-butylphenol, 97%, 4-Bromo-2,6-di-tert-butylphenol, 4-Bromo-2,6-di-tert-butylphenol, >98.0%(GC), 4-Bromo-2,6-di-tert-butylphenol 98%, 4-Bromo-2,6-di-tert-butylphenol, 97%, 97%. Offered by: Combi-blocks, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 250g, 1000g, 10g.
4-bromo-2,6-ditert-butylphenol (CAS 1139-52-2) is a chemical compound with the molecular formula C14H21BrO and a molecular weight of 285.22 g/mol. IUPAC name: 4-bromo-2,6-ditert-butylphenol. InChIKey: SSQQUEKFNSJLKX-UHFFFAOYSA-N.
| Molecular formula | C14H21BrO |
|---|---|
| Molecular weight | 285.22 g/mol |
| IUPAC name | 4-bromo-2,6-ditert-butylphenol |
| InChIKey | SSQQUEKFNSJLKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)Br |
Computed by PubChem (NCBI)