CAS 1630057-76-9 is the registry number for 2-Bromo-4-isopropyl-1-(neopentyloxy)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(2,2-dimethylpropoxy)-4-propan-2-ylbenzene (CAS 1630057-76-9) is a chemical compound with the molecular formula C14H21BrO and a molecular weight of 285.22 g/mol. IUPAC name: 2-bromo-1-(2,2-dimethylpropoxy)-4-propan-2-ylbenzene. InChIKey: OBQIGSFMSQKYAU-UHFFFAOYSA-N.
| Molecular formula | C14H21BrO |
|---|---|
| Molecular weight | 285.22 g/mol |
| IUPAC name | 2-bromo-1-(2,2-dimethylpropoxy)-4-propan-2-ylbenzene |
| InChIKey | OBQIGSFMSQKYAU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1)OCC(C)(C)C)Br |
Computed by PubChem (NCBI)