CAS 1139245-78-5 appears in our catalog under these names: 4-Chloro-n,n-dimethyl-6-(propan-2-yl)-1,3,5-triazin-2-amine, 95%, 4-Chloro-6-isopropyl-N,N-dimethyl-1,3,5-triazin-2-amine, 95+%, 4-chloro-N,N-dimethyl-6-(propan-2-yl)-1,3,5-triazin-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 0,5g, 50mg.
4-chloro-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine (CAS 1139245-78-5) is a chemical compound with the molecular formula C8H13ClN4 and a molecular weight of 200.67 g/mol. IUPAC name: 4-chloro-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine. InChIKey: ZIQGDJRCQXROET-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN4 |
|---|---|
| Molecular weight | 200.67 g/mol |
| IUPAC name | 4-chloro-N,N-dimethyl-6-propan-2-yl-1,3,5-triazin-2-amine |
| InChIKey | ZIQGDJRCQXROET-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=NC(=N1)Cl)N(C)C |
Computed by PubChem (NCBI)