CAS 3289-38-1 is the registry number for 6-Chloro-n2,n2-diethylpyrimidine-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
6-chloro-2-N,2-N-diethylpyrimidine-2,4-diamine (CAS 3289-38-1) is a chemical compound with the molecular formula C8H13ClN4 and a molecular weight of 200.67 g/mol. IUPAC name: 6-chloro-2-N,2-N-diethylpyrimidine-2,4-diamine. InChIKey: XZIIFPSPUDAGJM-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN4 |
|---|---|
| Molecular weight | 200.67 g/mol |
| IUPAC name | 6-chloro-2-N,2-N-diethylpyrimidine-2,4-diamine |
| InChIKey | XZIIFPSPUDAGJM-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=NC(=CC(=N1)Cl)N |
Computed by PubChem (NCBI)