CAS 113957-09-8 is the registry number for Cebaracetam. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[2-[4-(4-chlorophenyl)-2-oxopyrrolidin-1-yl]acetyl]piperazin-2-one (CAS 113957-09-8) is a chemical compound with the molecular formula C16H18ClN3O3 and a molecular weight of 335.78 g/mol. IUPAC name: 4-[2-[4-(4-chlorophenyl)-2-oxopyrrolidin-1-yl]acetyl]piperazin-2-one. InChIKey: QPKMIYNBZGPJAR-UHFFFAOYSA-N.
| Molecular formula | C16H18ClN3O3 |
|---|---|
| Molecular weight | 335.78 g/mol |
| IUPAC name | 4-[2-[4-(4-chlorophenyl)-2-oxopyrrolidin-1-yl]acetyl]piperazin-2-one |
| InChIKey | QPKMIYNBZGPJAR-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=O)N1)C(=O)CN2CC(CC2=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)