Products 2836222-86-5
CAS 2836222-86-5 is the registry number for tert-Butyl (1-(7-chloro-4-oxo-3,4-dihydrophthalazin-1-yl)cyclopropyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[1-(7-chloro-4-oxo-3H-phthalazin-1-yl)cyclopropyl]carbamate (CAS 2836222-86-5) is a chemical compound with the molecular formula C16H18ClN3O3 and a molecular weight of 335.78 g/mol. IUPAC name: tert-butyl N-[1-(7-chloro-4-oxo-3H-phthalazin-1-yl)cyclopropyl]carbamate. InChIKey: BNHQKTUDNHLVND-UHFFFAOYSA-N.
| Molecular formula | C16H18ClN3O3 |
|---|---|
| Molecular weight | 335.78 g/mol |
| IUPAC name | tert-butyl N-[1-(7-chloro-4-oxo-3H-phthalazin-1-yl)cyclopropyl]carbamate |
| InChIKey | BNHQKTUDNHLVND-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CC1)C2=NNC(=O)C3=C2C=C(C=C3)Cl |
Computed by PubChem (NCBI)