CAS 113978-91-9 appears in our catalog under these names: Tributylphosphonium tetrafluoroborate, 98%, Tributylphosphine tetrafluoroborate, Tributylphosphonium tetrafluoroborate 98%, TRIBUTYLPHOSPHINE TETRAFLUOROBORATE,97%, Tributylphosphonium Tetrafluoroborate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 100g, 25g, 250mg, 500g, 10g.
Tributylphosphanium tetrafluoroborate (CAS 113978-91-9) is a chemical compound with the molecular formula C12H28BF4P and a molecular weight of 290.13 g/mol. IUPAC name: tributylphosphanium tetrafluoroborate. InChIKey: NCHAZLRRIGGCER-UHFFFAOYSA-O.
| Molecular formula | C12H28BF4P |
|---|---|
| Molecular weight | 290.13 g/mol |
| IUPAC name | tributylphosphanium tetrafluoroborate |
| InChIKey | NCHAZLRRIGGCER-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.CCCC[PH+](CCCC)CCCC |
Computed by PubChem (NCBI)