CAS 1816254-91-7 appears in our catalog under these names: Di-tert-butyl(butyl)phosphonium tetrafluoroborate, 98%, Di-tert-butyl(butyl)phosphonium tetrafluoroborate 98%, butyl(ditert-butyl)phosphane hydron tetrafluoroborate, 98%, 98%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 100g, 1g, 5g, 25g.
Butyl(ditert-butyl)phosphanium tetrafluoroborate (CAS 1816254-91-7) is a chemical compound with the molecular formula C12H28BF4P and a molecular weight of 290.13 g/mol. IUPAC name: butyl(ditert-butyl)phosphanium tetrafluoroborate. InChIKey: LRFPAUOJHILISZ-UHFFFAOYSA-O.
| Molecular formula | C12H28BF4P |
|---|---|
| Molecular weight | 290.13 g/mol |
| IUPAC name | butyl(ditert-butyl)phosphanium tetrafluoroborate |
| InChIKey | LRFPAUOJHILISZ-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.CCCC[PH+](C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)