CAS 113994-45-9 appears in our catalog under these names: Amlodipine Metabolite 4, O-Des(2-aminoethyl)-O-carboxymethyl dehydroamlodipine, >95% (HPLC), O-Des(2-aminoethyl)-O-carboxymethyl dehydroamlodipine, O–Des(2–aminoethyl)–O–carboxymethyl dehydroamlodipine, Amlodipine metabolite. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 1mg, 500ug, 5mg, 500μg, 1 mg.
2-[[4-(2-chlorophenyl)-3-ethoxycarbonyl-5-methoxycarbonyl-6-methyl-2-pyridinyl]methoxy]acetic acid (CAS 113994-45-9) is a chemical compound with the molecular formula C20H20ClNO7 and a molecular weight of 421.8 g/mol. IUPAC name: 2-[[4-(2-chlorophenyl)-3-ethoxycarbonyl-5-methoxycarbonyl-6-methyl-2-pyridinyl]methoxy]acetic acid. InChIKey: WYLSEDHKQJBUIA-UHFFFAOYSA-N.
| Molecular formula | C20H20ClNO7 |
|---|---|
| Molecular weight | 421.8 g/mol |
| IUPAC name | 2-[[4-(2-chlorophenyl)-3-ethoxycarbonyl-5-methoxycarbonyl-6-methyl-2-pyridinyl]methoxy]acetic acid |
| InChIKey | WYLSEDHKQJBUIA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(N=C1COCC(=O)O)C)C(=O)OC)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)