Products 183720-02-7
CAS 183720-02-7 appears in our catalog under these names: CL 316243, CL 316243 free acid, CL 316243 (free acid), 99.37%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg, 25 mg, 10mM/1mL, 10 mg.
5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylic acid (CAS 183720-02-7) is a chemical compound with the molecular formula C20H20ClNO7 and a molecular weight of 421.8 g/mol. IUPAC name: 5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylic acid. InChIKey: JEDJMKTVUPSHFW-ABAIWWIYSA-N.
| Molecular formula | C20H20ClNO7 |
|---|---|
| Molecular weight | 421.8 g/mol |
| IUPAC name | 5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylic acid |
| InChIKey | JEDJMKTVUPSHFW-ABAIWWIYSA-N |
| SMILES | C[C@H](CC1=CC2=C(C=C1)OC(O2)(C(=O)O)C(=O)O)NC[C@@H](C3=CC(=CC=C3)Cl)O |
Computed by PubChem (NCBI)