CAS 114-21-6 appears in our catalog under these names: Dl-mandelic acid sodium salt, 98%, Mandelic acid (sodium), Sodium DL-Mandelate, >99.0%(HPLC)(T), Sodium Mandelate 99%, Sodium DL-Mandelate, 99%, 99%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 10g.
Sodium 2-hydroxy-2-phenylacetate (CAS 114-21-6) is a chemical compound with the molecular formula C8H7NaO3 and a molecular weight of 174.13 g/mol. IUPAC name: sodium 2-hydroxy-2-phenylacetate. InChIKey: FWDLHTBMGQEUDU-UHFFFAOYSA-M.
| Molecular formula | C8H7NaO3 |
|---|---|
| Molecular weight | 174.13 g/mol |
| IUPAC name | sodium 2-hydroxy-2-phenylacetate |
| InChIKey | FWDLHTBMGQEUDU-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C(C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)