CAS 32768-20-0 appears in our catalog under these names: 3-Methylsalicylic acid sodium salt, 98%, Sodium 2–carboxy–6–methylphenolate, Sodium 3-Methylsalicylate, >97.0%(HPLC)(T), Sodium 2-hydroxy-3-methylbenzoate 98%, Benzoic acid, 2-hydroxy-3-methyl-, sodium salt (1:1), 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 100g, 25g, 1g.
Sodium 2-hydroxy-3-methylbenzoate (CAS 32768-20-0) is a chemical compound with the molecular formula C8H7NaO3 and a molecular weight of 174.13 g/mol. IUPAC name: sodium 2-hydroxy-3-methylbenzoate. InChIKey: ODAXNLPYGWAGTH-UHFFFAOYSA-M.
| Molecular formula | C8H7NaO3 |
|---|---|
| Molecular weight | 174.13 g/mol |
| IUPAC name | sodium 2-hydroxy-3-methylbenzoate |
| InChIKey | ODAXNLPYGWAGTH-UHFFFAOYSA-M |
| SMILES | CC1=C(C(=CC=C1)C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)