Products 1140528-25-1
CAS 1140528-25-1 is the registry number for U0124 1PC X 1MG. Offered by: Sigma-Aldrich. Available pack sizes: 1MG.
4-amino-2-[amino(methylsulfanyl)methylidene]-3-isocyano-4-methylsulfanylbut-3-enenitrile (CAS 1140528-25-1) is a chemical compound with the molecular formula C8H10N4S2 and a molecular weight of 226.3 g/mol. IUPAC name: 4-amino-2-[amino(methylsulfanyl)methylidene]-3-isocyano-4-methylsulfanylbut-3-enenitrile. InChIKey: QRTOSWGHCGATQF-UHFFFAOYSA-N.
| Molecular formula | C8H10N4S2 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 4-amino-2-[amino(methylsulfanyl)methylidene]-3-isocyano-4-methylsulfanylbut-3-enenitrile |
| InChIKey | QRTOSWGHCGATQF-UHFFFAOYSA-N |
| SMILES | CSC(=C(C#N)C(=C(N)SC)[N+]#[C-])N |
Computed by PubChem (NCBI)