CAS 263157-05-7 is the registry number for 5-(2,4-Dimethylthiazol-5-yl)-4-methyl-4H-1,2,4-triazole-3-thiol, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(2,4-dimethyl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione (CAS 263157-05-7) is a chemical compound with the molecular formula C8H10N4S2 and a molecular weight of 226.3 g/mol. IUPAC name: 3-(2,4-dimethyl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: VTPTUNHSVKMSOT-UHFFFAOYSA-N.
| Molecular formula | C8H10N4S2 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 3-(2,4-dimethyl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
| InChIKey | VTPTUNHSVKMSOT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C)C2=NNC(=S)N2C |
Computed by PubChem (NCBI)