CAS 2591-01-7 appears in our catalog under these names: 1,3-Phenylene-bis(2-thiourea), 95%, 1,3-Phenylene-bis(2-thiourea). Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 5g.
[3-(carbamothioylamino)phenyl]thiourea (CAS 2591-01-7) is a chemical compound with the molecular formula C8H10N4S2 and a molecular weight of 226.3 g/mol. IUPAC name: [3-(carbamothioylamino)phenyl]thiourea. InChIKey: PZMVHTFOYWAHTK-UHFFFAOYSA-N.
| Molecular formula | C8H10N4S2 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | [3-(carbamothioylamino)phenyl]thiourea |
| InChIKey | PZMVHTFOYWAHTK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=S)N)NC(=S)N |
Computed by PubChem (NCBI)