Products 114092-59-0
CAS 114092-59-0 is the registry number for 1-((E)-2-Bromoethenyl)-3-(trifluoromethyl)benzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(E)-2-bromoethenyl]-3-(trifluoromethyl)benzene (CAS 114092-59-0) is a chemical compound with the molecular formula C9H6BrF3 and a molecular weight of 251.04 g/mol. IUPAC name: 1-[(E)-2-bromoethenyl]-3-(trifluoromethyl)benzene. InChIKey: SORYLDUWQMEDRE-SNAWJCMRSA-N.
| Molecular formula | C9H6BrF3 |
|---|---|
| Molecular weight | 251.04 g/mol |
| IUPAC name | 1-[(E)-2-bromoethenyl]-3-(trifluoromethyl)benzene |
| InChIKey | SORYLDUWQMEDRE-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)/C=C/Br |
Computed by PubChem (NCBI)