CAS 2879222-05-4 is the registry number for 4-Bromo-1,1,7-trifluoro-2,3-dihydro-1H-indene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-3,3,4-trifluoro-1,2-dihydroindene (CAS 2879222-05-4) is a chemical compound with the molecular formula C9H6BrF3 and a molecular weight of 251.04 g/mol. IUPAC name: 7-bromo-3,3,4-trifluoro-1,2-dihydroindene. InChIKey: JWPMFKUPEVQPKY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3 |
|---|---|
| Molecular weight | 251.04 g/mol |
| IUPAC name | 7-bromo-3,3,4-trifluoro-1,2-dihydroindene |
| InChIKey | JWPMFKUPEVQPKY-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C=CC(=C21)Br)F)(F)F |
Computed by PubChem (NCBI)