CAS 1141056-98-5 is the registry number for tert-Butyl (3s,4r)-4-(aminomethyl)-3-hydroxypiperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 1g, 250mg.
Tert-butyl (3S,4R)-4-(aminomethyl)-3-hydroxypiperidine-1-carboxylate (CAS 1141056-98-5) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl (3S,4R)-4-(aminomethyl)-3-hydroxypiperidine-1-carboxylate. InChIKey: GAGALXYDHSHHCD-RKDXNWHRSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl (3S,4R)-4-(aminomethyl)-3-hydroxypiperidine-1-carboxylate |
| InChIKey | GAGALXYDHSHHCD-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@@H](C1)O)CN |
Computed by PubChem (NCBI)