CAS 219985-15-6 appears in our catalog under these names: Cis-1-boc-4-aminomethyl-3-hydroxypiperidine, 95%, cis–1–Boc–4–aminomethyl–3–hydroxypiperidine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl (3R,4S)-4-(aminomethyl)-3-hydroxypiperidine-1-carboxylate (CAS 219985-15-6) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl (3R,4S)-4-(aminomethyl)-3-hydroxypiperidine-1-carboxylate. InChIKey: GAGALXYDHSHHCD-IUCAKERBSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl (3R,4S)-4-(aminomethyl)-3-hydroxypiperidine-1-carboxylate |
| InChIKey | GAGALXYDHSHHCD-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)O)CN |
Computed by PubChem (NCBI)