CAS 1141474-11-4 is the registry number for Methyl 2-hydroxy-2'-methyl-[1,1'-biphenyl]-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 3-hydroxy-4-(2-methylphenyl)benzoate (CAS 1141474-11-4) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: methyl 3-hydroxy-4-(2-methylphenyl)benzoate. InChIKey: CNCOOZAUEOKHOY-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | methyl 3-hydroxy-4-(2-methylphenyl)benzoate |
| InChIKey | CNCOOZAUEOKHOY-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=C(C=C(C=C2)C(=O)OC)O |
Computed by PubChem (NCBI)