Products 1142-39-8
CAS 1142-39-8 appears in our catalog under these names: 4–(Hexyloxy)benzoic Acid, 4-Hexyloxybenzoic acid, 4-(Hexyloxy)benzoic Acid, >98.0%(GC)(T), 4-(Hexyloxy)benzoic acid 95%, 4-(Hexyloxy)benzoic Acid, 95%, 95%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 500g, 10g, 50g, 5g.
4-hexoxybenzoic acid (CAS 1142-39-8) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 4-hexoxybenzoic acid. InChIKey: HBQUXMZZODHFMJ-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 4-hexoxybenzoic acid |
| InChIKey | HBQUXMZZODHFMJ-UHFFFAOYSA-N |
| SMILES | CCCCCCOC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)