CAS 1142192-09-3 is the registry number for tert-Butyl 6-chloro-5-pivalamidopyridin-2-ylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-[6-chloro-5-(2,2-dimethylpropanoylamino)-2-pyridinyl]carbamate (CAS 1142192-09-3) is a chemical compound with the molecular formula C15H22ClN3O3 and a molecular weight of 327.80 g/mol. IUPAC name: tert-butyl N-[6-chloro-5-(2,2-dimethylpropanoylamino)-2-pyridinyl]carbamate. InChIKey: GMQIMSAHJLTCOX-UHFFFAOYSA-N.
| Molecular formula | C15H22ClN3O3 |
|---|---|
| Molecular weight | 327.80 g/mol |
| IUPAC name | tert-butyl N-[6-chloro-5-(2,2-dimethylpropanoylamino)-2-pyridinyl]carbamate |
| InChIKey | GMQIMSAHJLTCOX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(N=C(C=C1)NC(=O)OC(C)(C)C)Cl |
Computed by PubChem (NCBI)