CAS 142228-17-9 appears in our catalog under these names: Metoclopramide Impurity 38, TKS 159. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
4-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide (CAS 142228-17-9) is a chemical compound with the molecular formula C15H22ClN3O3 and a molecular weight of 327.80 g/mol. IUPAC name: 4-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide. InChIKey: DXCDZNHWSCWICI-UWVGGRQHSA-N.
| Molecular formula | C15H22ClN3O3 |
|---|---|
| Molecular weight | 327.80 g/mol |
| IUPAC name | 4-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide |
| InChIKey | DXCDZNHWSCWICI-UWVGGRQHSA-N |
| SMILES | CCN1C[C@H](C[C@H]1CO)NC(=O)C2=CC(=C(C=C2OC)N)Cl |
Computed by PubChem (NCBI)