CAS 1142202-80-9 is the registry number for 4-[5-(Anilinocarbonyl)-1,3,4-thiadiazol-2-yl]butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]butanoic acid (CAS 1142202-80-9) is a chemical compound with the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. IUPAC name: 4-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]butanoic acid. InChIKey: XCTGVXVKTZPJIM-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O3S |
|---|---|
| Molecular weight | 291.33 g/mol |
| IUPAC name | 4-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]butanoic acid |
| InChIKey | XCTGVXVKTZPJIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=NN=C(S2)CCCC(=O)O |
Computed by PubChem (NCBI)