Products 1142202-80-9

CAS 1142202-80-9 is the registry number for 4-[5-(Anilinocarbonyl)-1,3,4-thiadiazol-2-yl]butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]butanoic acid (CAS 1142202-80-9) is a chemical compound with the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. IUPAC name: 4-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]butanoic acid. InChIKey: XCTGVXVKTZPJIM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13N3O3S
Molecular weight291.33 g/mol
IUPAC name4-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]butanoic acid
InChIKeyXCTGVXVKTZPJIM-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)NC(=O)C2=NN=C(S2)CCCC(=O)O

Computed by PubChem (NCBI)