CAS 1365244-64-9 is the registry number for 4-((2-(2-Amino-4-thiazolyl)acetyl)amino)-benzeneacetic Acid. Offered by: TRC. Available pack sizes: 50mg.
2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]acetic acid (CAS 1365244-64-9) is a chemical compound with the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. IUPAC name: 2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]acetic acid. InChIKey: ZFNAUJGSRYDGNB-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O3S |
|---|---|
| Molecular weight | 291.33 g/mol |
| IUPAC name | 2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]acetic acid |
| InChIKey | ZFNAUJGSRYDGNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)NC(=O)CC2=CSC(=N2)N |
Computed by PubChem (NCBI)