CAS 1142207-94-0 is the registry number for 4-Amino-6-(4-isopropylphenyl)-1,6-dihydro-1,3,5-triazine-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-amino-2-(4-propan-2-ylphenyl)-2,5-dihydro-1H-1,3,5-triazine-6-thione (CAS 1142207-94-0) is a chemical compound with the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. IUPAC name: 4-amino-2-(4-propan-2-ylphenyl)-2,5-dihydro-1H-1,3,5-triazine-6-thione. InChIKey: FSMMSEOGNZUBRM-UHFFFAOYSA-N.
| Molecular formula | C12H16N4S |
|---|---|
| Molecular weight | 248.35 g/mol |
| IUPAC name | 4-amino-2-(4-propan-2-ylphenyl)-2,5-dihydro-1H-1,3,5-triazine-6-thione |
| InChIKey | FSMMSEOGNZUBRM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2NC(=S)NC(=N2)N |
Computed by PubChem (NCBI)