CAS 1275171-77-1 appears in our catalog under these names: 2-(4-Methylpiperazin-1-yl)-1,3-benzothiazol-6-amine, 95%, 2-(4-Methylpiperazin-1-yl)-1,3-benzothiazol-6-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g, 50mg.
2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-amine (CAS 1275171-77-1) is a chemical compound with the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. IUPAC name: 2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-amine. InChIKey: LIDFZJSMIUQYTK-UHFFFAOYSA-N.
| Molecular formula | C12H16N4S |
|---|---|
| Molecular weight | 248.35 g/mol |
| IUPAC name | 2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-amine |
| InChIKey | LIDFZJSMIUQYTK-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=C(S2)C=C(C=C3)N |
Computed by PubChem (NCBI)