Products 2267291-23-4
CAS 2267291-23-4 is the registry number for tert-Butyl 7-(3-oxopropyl)-5H-pyrido[4,3-b]indole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 7-(3-oxopropyl)pyrido[4,3-b]indole-5-carboxylate (CAS 2267291-23-4) is a chemical compound with the molecular formula C19H20N2O3 and a molecular weight of 324.4 g/mol. IUPAC name: tert-butyl 7-(3-oxopropyl)pyrido[4,3-b]indole-5-carboxylate. InChIKey: DXJBXGZEGGTFNX-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O3 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | tert-butyl 7-(3-oxopropyl)pyrido[4,3-b]indole-5-carboxylate |
| InChIKey | DXJBXGZEGGTFNX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=NC=C2)C3=C1C=C(C=C3)CCC=O |
Computed by PubChem (NCBI)