CAS 1142363-62-9 is the registry number for 2-Bromo-6-(2,2,6,6-tetramethyltetrahydro-2H-pyran-4-yl)pyridin-3-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-6-(2,2,6,6-tetramethyloxan-4-yl)pyridin-3-amine (CAS 1142363-62-9) is a chemical compound with the molecular formula C14H21BrN2O and a molecular weight of 313.23 g/mol. IUPAC name: 2-bromo-6-(2,2,6,6-tetramethyloxan-4-yl)pyridin-3-amine. InChIKey: QMJRZYBRTXNTCC-UHFFFAOYSA-N.
| Molecular formula | C14H21BrN2O |
|---|---|
| Molecular weight | 313.23 g/mol |
| IUPAC name | 2-bromo-6-(2,2,6,6-tetramethyloxan-4-yl)pyridin-3-amine |
| InChIKey | QMJRZYBRTXNTCC-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(O1)(C)C)C2=NC(=C(C=C2)N)Br)C |
Computed by PubChem (NCBI)