CAS 1217486-79-7 is the registry number for 6-Bromo-1-(tert-butyl)-2-ethoxy-2-methyl-2,3-dihydro-1H-benzo[d]imidazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-tert-butyl-2-ethoxy-2-methyl-1H-benzimidazole (CAS 1217486-79-7) is a chemical compound with the molecular formula C14H21BrN2O and a molecular weight of 313.23 g/mol. IUPAC name: 5-bromo-3-tert-butyl-2-ethoxy-2-methyl-1H-benzimidazole. InChIKey: MAFRHHOYEOYANK-UHFFFAOYSA-N.
| Molecular formula | C14H21BrN2O |
|---|---|
| Molecular weight | 313.23 g/mol |
| IUPAC name | 5-bromo-3-tert-butyl-2-ethoxy-2-methyl-1H-benzimidazole |
| InChIKey | MAFRHHOYEOYANK-UHFFFAOYSA-N |
| SMILES | CCOC1(NC2=C(N1C(C)(C)C)C=C(C=C2)Br)C |
Computed by PubChem (NCBI)