CAS 1142815-95-9 is the registry number for rac-((1R,2R)-2-(3-Methoxyphenyl)cyclopropyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[(1R,2R)-2-(3-methoxyphenyl)cyclopropyl]methanamine;hydrochloride (CAS 1142815-95-9) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: [(1R,2R)-2-(3-methoxyphenyl)cyclopropyl]methanamine;hydrochloride. InChIKey: ABWWRNPKXWVLTE-ROLPUNSJSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | [(1R,2R)-2-(3-methoxyphenyl)cyclopropyl]methanamine;hydrochloride |
| InChIKey | ABWWRNPKXWVLTE-ROLPUNSJSA-N |
| SMILES | COC1=CC=CC(=C1)[C@@H]2C[C@H]2CN.Cl |
Computed by PubChem (NCBI)