CAS 114303-79-6 is the registry number for 8-Chloro-1,3-dimethyl-7-(oxiran-2-ylmethyl)-3,7-dihydro-1H-purine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-1,3-dimethyl-7-(oxiran-2-ylmethyl)purine-2,6-dione (CAS 114303-79-6) is a chemical compound with the molecular formula C10H11ClN4O3 and a molecular weight of 270.67 g/mol. IUPAC name: 8-chloro-1,3-dimethyl-7-(oxiran-2-ylmethyl)purine-2,6-dione. InChIKey: JALJPBUMHBYGDH-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4O3 |
|---|---|
| Molecular weight | 270.67 g/mol |
| IUPAC name | 8-chloro-1,3-dimethyl-7-(oxiran-2-ylmethyl)purine-2,6-dione |
| InChIKey | JALJPBUMHBYGDH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C(=N2)Cl)CC3CO3 |
Computed by PubChem (NCBI)