CAS 6982-08-7 is the registry number for 6-Chloro-9-(3-deoxy-β-D-erythro-pentofuranosyl)-9H-purine, 97%, 97%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.
(2R,3R,5S)-2-(6-chloropurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol (CAS 6982-08-7) is a chemical compound with the molecular formula C10H11ClN4O3 and a molecular weight of 270.67 g/mol. IUPAC name: (2R,3R,5S)-2-(6-chloropurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol. InChIKey: GTFKHUYSYOGXNT-BAJZRUMYSA-N.
| Molecular formula | C10H11ClN4O3 |
|---|---|
| Molecular weight | 270.67 g/mol |
| IUPAC name | (2R,3R,5S)-2-(6-chloropurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol |
| InChIKey | GTFKHUYSYOGXNT-BAJZRUMYSA-N |
| SMILES | C1[C@H](O[C@H]([C@@H]1O)N2C=NC3=C2N=CN=C3Cl)CO |
Computed by PubChem (NCBI)