CAS 1143572-00-2 is the registry number for 1,1-Dimethylethyl N-[(Z)-[[(1,1-dimethylethoxy)carbonyl]amino]-1H-pyrazol-1-ylmethylene]carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
Tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-pyrazol-1-ylmethylidene]carbamate (CAS 1143572-00-2) is a chemical compound with the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. IUPAC name: tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-pyrazol-1-ylmethylidene]carbamate. InChIKey: QFNFDHNZVTWZED-UHFFFAOYSA-N.
| Molecular formula | C14H22N4O4 |
|---|---|
| Molecular weight | 310.35 g/mol |
| IUPAC name | tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-pyrazol-1-ylmethylidene]carbamate |
| InChIKey | QFNFDHNZVTWZED-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N/C(=N/C(=O)OC(C)(C)C)/N1C=CC=N1 |
Computed by PubChem (NCBI)