CAS 114446-51-4 appears in our catalog under these names: (S)-1-(3-Chloro-1-phenylpropoxy)-4-(trifluoromethyl)benzene, 98%, Desamino Chloro (S)-Fluoxetine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
1-[(1S)-3-chloro-1-phenylpropoxy]-4-(trifluoromethyl)benzene (CAS 114446-51-4) is a chemical compound with the molecular formula C16H14ClF3O and a molecular weight of 314.73 g/mol. IUPAC name: 1-[(1S)-3-chloro-1-phenylpropoxy]-4-(trifluoromethyl)benzene. InChIKey: VOPIMWRKIKTDPS-HNNXBMFYSA-N.
| Molecular formula | C16H14ClF3O |
|---|---|
| Molecular weight | 314.73 g/mol |
| IUPAC name | 1-[(1S)-3-chloro-1-phenylpropoxy]-4-(trifluoromethyl)benzene |
| InChIKey | VOPIMWRKIKTDPS-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CCCl)OC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)