CAS 1346617-29-5 is the registry number for Desamino Chloro (R)-Fluoxetine. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
1-[(1R)-3-chloro-1-[4-(trifluoromethyl)phenoxy]propyl]-2,3,4,5,6-pentadeuteriobenzene (CAS 1346617-29-5) is a chemical compound with the molecular formula C16H14ClF3O and a molecular weight of 319.76 g/mol. IUPAC name: 1-[(1R)-3-chloro-1-[4-(trifluoromethyl)phenoxy]propyl]-2,3,4,5,6-pentadeuteriobenzene. InChIKey: VOPIMWRKIKTDPS-HCESTMGSSA-N.
| Molecular formula | C16H14ClF3O |
|---|---|
| Molecular weight | 319.76 g/mol |
| IUPAC name | 1-[(1R)-3-chloro-1-[4-(trifluoromethyl)phenoxy]propyl]-2,3,4,5,6-pentadeuteriobenzene |
| InChIKey | VOPIMWRKIKTDPS-HCESTMGSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])[C@@H](CCCl)OC2=CC=C(C=C2)C(F)(F)F)[2H])[2H] |
Computed by PubChem (NCBI)