CAS 1144534-31-5 is the registry number for NCI-14465. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-N-(4-methylphenyl)-2-N-naphthalen-2-yl-1,3,5-triazine-2,4,6-triamine;hydrochloride (CAS 1144534-31-5) is a chemical compound with the molecular formula C20H19ClN6 and a molecular weight of 378.9 g/mol. IUPAC name: 4-N-(4-methylphenyl)-2-N-naphthalen-2-yl-1,3,5-triazine-2,4,6-triamine;hydrochloride. InChIKey: VXFFFBDPDNIKCU-UHFFFAOYSA-N.
| Molecular formula | C20H19ClN6 |
|---|---|
| Molecular weight | 378.9 g/mol |
| IUPAC name | 4-N-(4-methylphenyl)-2-N-naphthalen-2-yl-1,3,5-triazine-2,4,6-triamine;hydrochloride |
| InChIKey | VXFFFBDPDNIKCU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=NC(=NC(=N2)N)NC3=CC4=CC=CC=C4C=C3.Cl |
Computed by PubChem (NCBI)