Products 2568607-82-7
CAS 2568607-82-7 is the registry number for GaMF1.39. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-N-[2-(4-chlorophenyl)-3H-benzimidazol-5-yl]-4-N-ethyl-6-methylpyrimidine-2,4-diamine (CAS 2568607-82-7) is a chemical compound with the molecular formula C20H19ClN6 and a molecular weight of 378.9 g/mol. IUPAC name: 2-N-[2-(4-chlorophenyl)-3H-benzimidazol-5-yl]-4-N-ethyl-6-methylpyrimidine-2,4-diamine. InChIKey: DKJYWYHLAHWVCH-UHFFFAOYSA-N.
| Molecular formula | C20H19ClN6 |
|---|---|
| Molecular weight | 378.9 g/mol |
| IUPAC name | 2-N-[2-(4-chlorophenyl)-3H-benzimidazol-5-yl]-4-N-ethyl-6-methylpyrimidine-2,4-diamine |
| InChIKey | DKJYWYHLAHWVCH-UHFFFAOYSA-N |
| SMILES | CCNC1=NC(=NC(=C1)C)NC2=CC3=C(C=C2)N=C(N3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)
Synonyms:
GaMF1.39, orb2566192