CAS 114525-94-9 is the registry number for N-Me-Phe-OtBu, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (2S)-2-(methylamino)-3-phenylpropanoate (CAS 114525-94-9) is a chemical compound with the molecular formula C14H21NO2 and a molecular weight of 235.32 g/mol. IUPAC name: tert-butyl (2S)-2-(methylamino)-3-phenylpropanoate. InChIKey: UZKARLOPBFXQHH-LBPRGKRZSA-N.
| Molecular formula | C14H21NO2 |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | tert-butyl (2S)-2-(methylamino)-3-phenylpropanoate |
| InChIKey | UZKARLOPBFXQHH-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC1=CC=CC=C1)NC |
Computed by PubChem (NCBI)