CAS 114559-25-0 appears in our catalog under these names: H–Dap(Boc)–OMe · HCl, H-L-Dap(Boc)-OMe*HCl, H-Dap(Boc)-OMe·HCl 97%, methyl (S)-2-amino-3-((tert-butoxycarbonyl)amino)propanoate hydrochloride, 97%, 97%, (S)-Methyl 2-amino-3-((tert-butoxycarbonyl)amino)propanoate hydrochloride, 95%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg, 10g, 100g.
Methyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride (CAS 114559-25-0) is a chemical compound with the molecular formula C9H19ClN2O4 and a molecular weight of 254.71 g/mol. IUPAC name: methyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride. InChIKey: GDJLJNFNXINTHS-RGMNGODLSA-N.
| Molecular formula | C9H19ClN2O4 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride |
| InChIKey | GDJLJNFNXINTHS-RGMNGODLSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)