CAS 919792-96-4 appears in our catalog under these names: 3-BOC-D-2,3-Diaminopropionic acid methyl ester hydrochloride, 98%, (R)-Methyl 2-amino-3-((tert-butoxycarbonyl)amino)propanoate hydrochloride, 98%, (R)–Methyl 2–amino–3–((tert–butoxycarbonyl)amino)propanoate hydrochloride, 3-BOC-D-2,3-Diaminopropionic acid methyl ester HCl, 95%, 95%, D-a,b-Diaminopropionic acid(Boc) methyl ester hydrochloride, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 10g, 250mg.
Methyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride (CAS 919792-96-4) is a chemical compound with the molecular formula C9H19ClN2O4 and a molecular weight of 254.71 g/mol. IUPAC name: methyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride. InChIKey: GDJLJNFNXINTHS-FYZOBXCZSA-N.
| Molecular formula | C9H19ClN2O4 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride |
| InChIKey | GDJLJNFNXINTHS-FYZOBXCZSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)