CAS 1145678-75-6 appears in our catalog under these names: N-((9H-Fluoren-9-ylmethoxy)carbonyl)-2-methyl-L-tyrosine, Fmoc-L-Tyr(2-Me)-OH, 98%. Offered by: TRC, Ambeed. Available pack sizes: 100mg, 50mg, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-2-methylphenyl)propanoic acid (CAS 1145678-75-6) is a chemical compound with the molecular formula C25H23NO5 and a molecular weight of 417.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-2-methylphenyl)propanoic acid. InChIKey: MEFNXNKFGAIWBC-QHCPKHFHSA-N.
| Molecular formula | C25H23NO5 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-2-methylphenyl)propanoic acid |
| InChIKey | MEFNXNKFGAIWBC-QHCPKHFHSA-N |
| SMILES | CC1=C(C=CC(=C1)O)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)