CAS 1146291-81-7 appears in our catalog under these names: 4-Fluoro-1-methyl-1h-indole-2-carboxylic acid, 97%, 4-Fluoro-1-methyl-1H-indole-2-carboxylic acid, 98%, 4–Fluoro–1–methyl–1H–indole–2–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-fluoro-1-methylindole-2-carboxylic acid (CAS 1146291-81-7) is a chemical compound with the molecular formula C10H8FNO2 and a molecular weight of 193.17 g/mol. IUPAC name: 4-fluoro-1-methylindole-2-carboxylic acid. InChIKey: XVDTYNUXKKGOSU-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO2 |
|---|---|
| Molecular weight | 193.17 g/mol |
| IUPAC name | 4-fluoro-1-methylindole-2-carboxylic acid |
| InChIKey | XVDTYNUXKKGOSU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C1C(=O)O)C(=CC=C2)F |
Computed by PubChem (NCBI)