Products 1146294-36-1

CAS 1146294-36-1 is the registry number for 8-Methylcinnoline-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

8-methylcinnoline-3-carboxylic acid (CAS 1146294-36-1) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 8-methylcinnoline-3-carboxylic acid. InChIKey: NGXBNUBKGNITKG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8N2O2
Molecular weight188.18 g/mol
IUPAC name8-methylcinnoline-3-carboxylic acid
InChIKeyNGXBNUBKGNITKG-UHFFFAOYSA-N
SMILESCC1=C2C(=CC=C1)C=C(N=N2)C(=O)O

Computed by PubChem (NCBI)