CAS 114636-02-1 is the registry number for 1,3-Difluoro-4-methoxy-2-(trimethylsilyl)benzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
(2,6-difluoro-3-methoxyphenyl)-trimethylsilane (CAS 114636-02-1) is a chemical compound with the molecular formula C10H14F2OSi and a molecular weight of 216.30 g/mol. IUPAC name: (2,6-difluoro-3-methoxyphenyl)-trimethylsilane. InChIKey: HFQBTBSSGJSKRE-UHFFFAOYSA-N.
| Molecular formula | C10H14F2OSi |
|---|---|
| Molecular weight | 216.30 g/mol |
| IUPAC name | (2,6-difluoro-3-methoxyphenyl)-trimethylsilane |
| InChIKey | HFQBTBSSGJSKRE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)[Si](C)(C)C)F |
Computed by PubChem (NCBI)