CAS 2586126-64-7 appears in our catalog under these names: (2,3-Difluoro-6-methoxyphenyl)trimethylsilane, 95%, (2,3-Difluoro-6-methoxyphenyl)trimethylsilane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(2,3-difluoro-6-methoxyphenyl)-trimethylsilane (CAS 2586126-64-7) is a chemical compound with the molecular formula C10H14F2OSi and a molecular weight of 216.30 g/mol. IUPAC name: (2,3-difluoro-6-methoxyphenyl)-trimethylsilane. InChIKey: PSTNIGCIISRVKX-UHFFFAOYSA-N.
| Molecular formula | C10H14F2OSi |
|---|---|
| Molecular weight | 216.30 g/mol |
| IUPAC name | (2,3-difluoro-6-methoxyphenyl)-trimethylsilane |
| InChIKey | PSTNIGCIISRVKX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)F)[Si](C)(C)C |
Computed by PubChem (NCBI)