CAS 1146699-58-2 appears in our catalog under these names: (R)-2-Amino-5,5,5-trifluoropentanamide hydrochloride, 95%, (R)-2-Amino-5,5,5-trifluoropentanamide hydrochloride, 95%, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(2R)-2-amino-5,5,5-trifluoropentanamide;hydrochloride (CAS 1146699-58-2) is a chemical compound with the molecular formula C5H10ClF3N2O and a molecular weight of 206.59 g/mol. IUPAC name: (2R)-2-amino-5,5,5-trifluoropentanamide;hydrochloride. InChIKey: GDTKAFYBAAISCN-AENDTGMFSA-N.
| Molecular formula | C5H10ClF3N2O |
|---|---|
| Molecular weight | 206.59 g/mol |
| IUPAC name | (2R)-2-amino-5,5,5-trifluoropentanamide;hydrochloride |
| InChIKey | GDTKAFYBAAISCN-AENDTGMFSA-N |
| SMILES | C(CC(F)(F)F)[C@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)