CAS 2438857-86-2 is the registry number for (S)-2-Amino-5,5,5-trifluoropentanamide hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-5,5,5-trifluoropentanamide;hydrochloride (CAS 2438857-86-2) is a chemical compound with the molecular formula C5H10ClF3N2O and a molecular weight of 206.59 g/mol. IUPAC name: (2S)-2-amino-5,5,5-trifluoropentanamide;hydrochloride. InChIKey: GDTKAFYBAAISCN-DFWYDOINSA-N.
| Molecular formula | C5H10ClF3N2O |
|---|---|
| Molecular weight | 206.59 g/mol |
| IUPAC name | (2S)-2-amino-5,5,5-trifluoropentanamide;hydrochloride |
| InChIKey | GDTKAFYBAAISCN-DFWYDOINSA-N |
| SMILES | C(CC(F)(F)F)[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)